QSAR Pipeline: Solubility Prediction
In this tutorial, we will build a Random Forest model to predict the aqueous solubility of molecules using MolecularFingerprints.jl and DecisionTree.jl.
1. Setup and Data Loading
We will use a small subset of the Delaney (ESOL) dataset. For this demo, we mock the data loading, but you would normally use CSV.read.
using Random
using Statistics
using DecisionTree
using MolecularFingerprints
using MolecularGraph
# For reproducibility
seed!(42)
# Small subset of the Delaney Solubility Dataset (SMILES, Measured LogS)
data = [
("CCO", 0.8), # Ethanol (High solubility)
("CC(=O)Oc1ccccc1C(=O)O", -2.1), # Aspirin (Moderate)
("c1ccccc1", -2.0), # Benzene (Low)
("CCCCCCCC", -4.5), # Octane (Very Low)
("O=C(C)Oc1ccccc1C(=O)O", -2.2), # Aspirin analog
("CN1C=NC2=C1C(=O)N(C(=O)N2C)C", -0.9) # Caffeine
]
# Separate X (SMILES) and y (Labels)
smiles_list = [d[1] for d in data]
y = [d[2] for d in data]2. Feature Generation (Fingerprinting)
We convert the raw SMILES strings into fixed-length numeric vectors using ECFP4.
# Parse SMILES to GraphMol objects
mols = [smilestomol(s) for s in smiles_list]
# Define the featurizer
featurizer_ecfp = ECFP{2}(2) # 2048-bit ECFP with radius 2
featurizer_maccs = MACCS(true, false) # MACCS keys
# Generate BitVectors
# Note: DecisionTree.jl expects a standard Matrix{Float64} or Matrix{Int}
fingerprints = [fingerprint(m, featurizer_ecfp) for m in mols]
# Convert Vector of BitVectors to a Matrix (Samples x Features)
# We transpose (') because hcat stacks them as columns
X = hcat(fingerprints...)'
X = Matrix(X) # Convert to standard dense matrix for ML3. Model Training
# Train/Test Split (Simple 80/20 manual split for demo)
n_samples = length(y)
train_idx = shuffle(1:n_samples)[1:floor(Int, 0.8*n_samples)]
test_idx = setdiff(1:n_samples, train_idx)
X_train, y_train = X[train_idx, :], y[train_idx]
X_test, y_test = X[test_idx, :], y[test_idx]
# Initialize and Train Model
# n_trees=10, min_samples=2
model = build_forest(y_train, X_train, 2, 10, 0.7, -1)
println("Model Trained successfully!")4. Model Evaluation
# Predict on Test Set
preds = apply_forest(model, X_test)
rmse = sqrt(mean((preds .- y_test).^2))
println("Test RMSE: $rmse")
# Inference on New Molecule
new_mol_smiles = "CC(=O)N" # Acetamide
new_mol = smilestomol(new_mol_smiles)
new_fp = fingerprint(new_mol, featurizer_ecfp)
# Reshape to 1xN Matrix for prediction
new_X = reshape(new_fp, 1, length(new_fp))
predicted_solubility = apply_forest(model, new_X)[1]
println("Predicted Solubility for $new_mol_smiles: $predicted_solubility")